About 5-acetamido-2,4-dichlorobenzamide
5-acetamido-2,4-dichlorobenzamide (PubChem CID 754552) has the molecular formula C9H8Cl2N2O2
and a molecular weight of 247.08 g/mol. Its IUPAC name is 5-acetamido-2,4-dichlorobenzamide.
Molecular Properties
| Compound Name | 5-acetamido-2,4-dichlorobenzamide |
| PubChem CID | 754552 |
| Molecular Formula | C9H8Cl2N2O2 |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 5-acetamido-2,4-dichlorobenzamide |
| SMILES | CC(=O)Nc1cc(C(N)=O)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2N2O2/c1-4(14)13-8-2-5(9(12)15)6(10)3-7(8)11/h2-3H,1H3,(H2,12,15)(H,13,14) |
| InChIKey | WVGYUADFCVQBKJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-acetamido-2,4-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetamido-2,4-dichlorobenzamide?
The IUPAC name of 5-acetamido-2,4-dichlorobenzamide (CID 754552) is 5-acetamido-2,4-dichlorobenzamide.
What is the SMILES notation for 5-acetamido-2,4-dichlorobenzamide?
The canonical SMILES for 5-acetamido-2,4-dichlorobenzamide is CC(=O)Nc1cc(C(N)=O)c(Cl)cc1Cl.
What is the InChIKey of 5-acetamido-2,4-dichlorobenzamide?
The InChIKey is WVGYUADFCVQBKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl2N2O2/c1-4(14)13-8-2-5(9(12)15)6(10)3-7(8)11/h2-3H,1H3,(H2,12,15)(H,13,14).
What are the key properties of 5-acetamido-2,4-dichlorobenzamide?
5-acetamido-2,4-dichlorobenzamide has a molecular weight of 247.08 g/mol, XLogP of 2.05, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetamido-2,4-dichlorobenzamide is sourced from PubChem (CID 754552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).