C23H23N3O4 — CID 75455566
N-[3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propyl]-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 75455566) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propyl]-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propyl]-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 75455566 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-[3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propyl]-3-methyl-5-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(-c2ccccc2)c1C(=O)NCCCN1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C23H23N3O4/c1-13-17(20(30-25-13)14-6-3-2-4-7-14)21(27)24-10-5-11-26-22(28)18-15-8-9-16(12-15)19(18)23(26)29/h2-4,6-9,15-16,18-19H,5,10-12H2,1H3,(H,24,27) |
| InChIKey | BURYCGNZMSSJEP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|