About 2-[(2-butyl-1,3-thiazol-4-yl)methyl-(2-hydroxyethyl)amino]-2-methylpropan-1-ol
2-[(2-butyl-1,3-thiazol-4-yl)methyl-(2-hydroxyethyl)amino]-2-methylpropan-1-ol (PubChem CID 75455978) has the molecular formula C14H26N2O2S
and a molecular weight of 286.44 g/mol. Its IUPAC name is 2-[(2-butyl-1,3-thiazol-4-yl)methyl-(2-hydroxyethyl)amino]-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 2-[(2-butyl-1,3-thiazol-4-yl)methyl-(2-hydroxyethyl)amino]-2-methylpropan-1-ol |
| PubChem CID | 75455978 |
| Molecular Formula | C14H26N2O2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2-[(2-butyl-1,3-thiazol-4-yl)methyl-(2-hydroxyethyl)amino]-2-methylpropan-1-ol |
| SMILES | CCCCc1nc(CN(CCO)C(C)(C)CO)cs1 |
| InChI | InChI=1S/C14H26N2O2S/c1-4-5-6-13-15-12(10-19-13)9-16(7-8-17)14(2,3)11-18/h10,17-18H,4-9,11H2,1-3H3 |
| InChIKey | VUYDGEANBZYEKG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-butyl-1,3-thiazol-4-yl)methyl-(2-hydroxyethyl)amino]-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-butyl-1,3-thiazol-4-yl)methyl-(2-hydroxyethyl)amino]-2-methylpropan-1-ol?
The IUPAC name of 2-[(2-butyl-1,3-thiazol-4-yl)methyl-(2-hydroxyethyl)amino]-2-methylpropan-1-ol (CID 75455978) is 2-[(2-butyl-1,3-thiazol-4-yl)methyl-(2-hydroxyethyl)amino]-2-methylpropan-1-ol.
What is the SMILES notation for 2-[(2-butyl-1,3-thiazol-4-yl)methyl-(2-hydroxyethyl)amino]-2-methylpropan-1-ol?
The canonical SMILES for 2-[(2-butyl-1,3-thiazol-4-yl)methyl-(2-hydroxyethyl)amino]-2-methylpropan-1-ol is CCCCc1nc(CN(CCO)C(C)(C)CO)cs1.
What is the InChIKey of 2-[(2-butyl-1,3-thiazol-4-yl)methyl-(2-hydroxyethyl)amino]-2-methylpropan-1-ol?
The InChIKey is VUYDGEANBZYEKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O2S/c1-4-5-6-13-15-12(10-19-13)9-16(7-8-17)14(2,3)11-18/h10,17-18H,4-9,11H2,1-3H3.
What are the key properties of 2-[(2-butyl-1,3-thiazol-4-yl)methyl-(2-hydroxyethyl)amino]-2-methylpropan-1-ol?
2-[(2-butyl-1,3-thiazol-4-yl)methyl-(2-hydroxyethyl)amino]-2-methylpropan-1-ol has a molecular weight of 286.44 g/mol, XLogP of 2.05, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-butyl-1,3-thiazol-4-yl)methyl-(2-hydroxyethyl)amino]-2-methylpropan-1-ol is sourced from PubChem (CID 75455978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).