About 4-chloro-5-[4-(2,2-diethoxyethyl)piperazin-1-yl]-2-phenylpyridazin-3-one
4-chloro-5-[4-(2,2-diethoxyethyl)piperazin-1-yl]-2-phenylpyridazin-3-one (PubChem CID 75457249) has the molecular formula C20H27ClN4O3
and a molecular weight of 406.91 g/mol. Its IUPAC name is 4-chloro-5-[4-(2,2-diethoxyethyl)piperazin-1-yl]-2-phenylpyridazin-3-one.
Molecular Properties
| Compound Name | 4-chloro-5-[4-(2,2-diethoxyethyl)piperazin-1-yl]-2-phenylpyridazin-3-one |
| PubChem CID | 75457249 |
| Molecular Formula | C20H27ClN4O3 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 4-chloro-5-[4-(2,2-diethoxyethyl)piperazin-1-yl]-2-phenylpyridazin-3-one |
| SMILES | CCOC(CN1CCN(c2cnn(-c3ccccc3)c(=O)c2Cl)CC1)OCC |
| InChI | InChI=1S/C20H27ClN4O3/c1-3-27-18(28-4-2)15-23-10-12-24(13-11-23)17-14-22-25(20(26)19(17)21)16-8-6-5-7-9-16/h5-9,14,18H,3-4,10-13,15H2,1-2H3 |
| InChIKey | HBQTUUCEBDDGDN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-[4-(2,2-diethoxyethyl)piperazin-1-yl]-2-phenylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-[4-(2,2-diethoxyethyl)piperazin-1-yl]-2-phenylpyridazin-3-one?
The IUPAC name of 4-chloro-5-[4-(2,2-diethoxyethyl)piperazin-1-yl]-2-phenylpyridazin-3-one (CID 75457249) is 4-chloro-5-[4-(2,2-diethoxyethyl)piperazin-1-yl]-2-phenylpyridazin-3-one.
What is the SMILES notation for 4-chloro-5-[4-(2,2-diethoxyethyl)piperazin-1-yl]-2-phenylpyridazin-3-one?
The canonical SMILES for 4-chloro-5-[4-(2,2-diethoxyethyl)piperazin-1-yl]-2-phenylpyridazin-3-one is CCOC(CN1CCN(c2cnn(-c3ccccc3)c(=O)c2Cl)CC1)OCC.
What is the InChIKey of 4-chloro-5-[4-(2,2-diethoxyethyl)piperazin-1-yl]-2-phenylpyridazin-3-one?
The InChIKey is HBQTUUCEBDDGDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27ClN4O3/c1-3-27-18(28-4-2)15-23-10-12-24(13-11-23)17-14-22-25(20(26)19(17)21)16-8-6-5-7-9-16/h5-9,14,18H,3-4,10-13,15H2,1-2H3.
What are the key properties of 4-chloro-5-[4-(2,2-diethoxyethyl)piperazin-1-yl]-2-phenylpyridazin-3-one?
4-chloro-5-[4-(2,2-diethoxyethyl)piperazin-1-yl]-2-phenylpyridazin-3-one has a molecular weight of 406.91 g/mol, XLogP of 2.41, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-[4-(2,2-diethoxyethyl)piperazin-1-yl]-2-phenylpyridazin-3-one is sourced from PubChem (CID 75457249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).