C25H31N3O3 — CID 7545728
4-benzyl-N-[(3S)-1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]piperidine-1-carboxamide (PubChem CID 7545728) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-benzyl-N-[(3S)-1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]piperidine-1-carboxamide.
| Compound Name | 4-benzyl-N-[(3S)-1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 7545728 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 4-benzyl-N-[(3S)-1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]piperidine-1-carboxamide |
| SMILES | CCOc1ccc(N2C[C@@H](NC(=O)N3CCC(Cc4ccccc4)CC3)CC2=O)cc1 |
| InChI | InChI=1S/C25H31N3O3/c1-2-31-23-10-8-22(9-11-23)28-18-21(17-24(28)29)26-25(30)27-14-12-20(13-15-27)16-19-6-4-3-5-7-19/h3-11,20-21H,2,12-18H2,1H3,(H,26,30)/t21-/m0/s1 |
| InChIKey | UITIJSPLUBPLGJ-NRFANRHFSA-N |
| XLogP | 3.85 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |