C8H18ClNOS — CID 75457891
2,2-diethyl-1,4-thiazinane 1-oxide;hydrochloride (PubChem CID 75457891) has the molecular formula C8H18ClNOS and a molecular weight of 211.76 g/mol. Its IUPAC name is 2,2-diethyl-1,4-thiazinane 1-oxide;hydrochloride.
| Compound Name | 2,2-diethyl-1,4-thiazinane 1-oxide;hydrochloride |
|---|---|
| PubChem CID | 75457891 |
| Molecular Formula | C8H18ClNOS |
| Molecular Weight | 211.76 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2,2-diethyl-1,4-thiazinane 1-oxide;hydrochloride |
| SMILES | CCC1(CC)CNCCS1=O.Cl |
| InChI | InChI=1S/C8H17NOS.ClH/c1-3-8(4-2)7-9-5-6-11(8)10;/h9H,3-7H2,1-2H3;1H |
| InChIKey | DXBCZDGFCRIZHD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.76 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |