C17H25N3O3 — CID 7545865
1-[(2S)-butan-2-yl]-3-[(3R)-1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]urea (PubChem CID 7545865) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-3-[(3R)-1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-[(2S)-butan-2-yl]-3-[(3R)-1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 7545865 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-3-[(3R)-1-(4-ethoxyphenyl)-5-oxopyrrolidin-3-yl]urea |
| SMILES | CCOc1ccc(N2C[C@H](NC(=O)N[C@@H](C)CC)CC2=O)cc1 |
| InChI | InChI=1S/C17H25N3O3/c1-4-12(3)18-17(22)19-13-10-16(21)20(11-13)14-6-8-15(9-7-14)23-5-2/h6-9,12-13H,4-5,10-11H2,1-3H3,(H2,18,19,22)/t12-,13+/m0/s1 |
| InChIKey | JQRJANZYLCXVSR-QWHCGFSZSA-N |
| XLogP | 2.29 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |