C14H17N3O4 — CID 75460025
2-(2,5-dioxoimidazolidin-4-yl)-N-[1-(2-methoxyphenyl)ethyl]acetamide (PubChem CID 75460025) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-4-yl)-N-[1-(2-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(2,5-dioxoimidazolidin-4-yl)-N-[1-(2-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 75460025 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-4-yl)-N-[1-(2-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccccc1C(C)NC(=O)CC1NC(=O)NC1=O |
| InChI | InChI=1S/C14H17N3O4/c1-8(9-5-3-4-6-11(9)21-2)15-12(18)7-10-13(19)17-14(20)16-10/h3-6,8,10H,7H2,1-2H3,(H,15,18)(H2,16,17,19,20) |
| InChIKey | QIBPMILXWIXIAL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|