C24H36N2O3 — CID 75460448
N-(1-adamantyl)-2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanamide (PubChem CID 75460448) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanamide.
| Compound Name | N-(1-adamantyl)-2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanamide |
|---|---|
| PubChem CID | 75460448 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | N-(1-adamantyl)-2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanamide |
| SMILES | COc1ccc(CCN(C)C(C)C(=O)NC23CC4CC(CC(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C24H36N2O3/c1-16(26(2)8-7-17-5-6-21(28-3)22(12-17)29-4)23(27)25-24-13-18-9-19(14-24)11-20(10-18)15-24/h5-6,12,16,18-20H,7-11,13-15H2,1-4H3,(H,25,27) |
| InChIKey | ZEQJDDZUHBOUKY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |