C12H17N3O4S — CID 75461426
1-methyl-5-(4-methylsulfonylpiperazine-1-carbonyl)pyridin-2-one (PubChem CID 75461426) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-methyl-5-(4-methylsulfonylpiperazine-1-carbonyl)pyridin-2-one.
| Compound Name | 1-methyl-5-(4-methylsulfonylpiperazine-1-carbonyl)pyridin-2-one |
|---|---|
| PubChem CID | 75461426 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-methyl-5-(4-methylsulfonylpiperazine-1-carbonyl)pyridin-2-one |
| SMILES | Cn1cc(C(=O)N2CCN(S(C)(=O)=O)CC2)ccc1=O |
| InChI | InChI=1S/C12H17N3O4S/c1-13-9-10(3-4-11(13)16)12(17)14-5-7-15(8-6-14)20(2,18)19/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | QAIUSZMKGWEWRS-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |