C17H29N3O4 — CID 75462551
1-(3-ethoxypropyl)-2-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(2-methoxyethyl)guanidine (PubChem CID 75462551) has the molecular formula C17H29N3O4 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(2-methoxyethyl)guanidine.
| Compound Name | 1-(3-ethoxypropyl)-2-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 75462551 |
| Molecular Formula | C17H29N3O4 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(2-methoxyethyl)guanidine |
| SMILES | CCOCCCN/C(=N/Cc1ccc(O)c(OC)c1)NCCOC |
| InChI | InChI=1S/C17H29N3O4/c1-4-24-10-5-8-18-17(19-9-11-22-2)20-13-14-6-7-15(21)16(12-14)23-3/h6-7,12,21H,4-5,8-11,13H2,1-3H3,(H2,18,19,20) |
| InChIKey | RRRAPXGSVUKZLS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|