C18H18FN3O3S — CID 75462718
2-fluoro-5-methyl-N-[4-[(1-methylimidazol-2-yl)methoxy]phenyl]benzenesulfonamide (PubChem CID 75462718) has the molecular formula C18H18FN3O3S and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-fluoro-5-methyl-N-[4-[(1-methylimidazol-2-yl)methoxy]phenyl]benzenesulfonamide.
| Compound Name | 2-fluoro-5-methyl-N-[4-[(1-methylimidazol-2-yl)methoxy]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 75462718 |
| Molecular Formula | C18H18FN3O3S |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 2-fluoro-5-methyl-N-[4-[(1-methylimidazol-2-yl)methoxy]phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(F)c(S(=O)(=O)Nc2ccc(OCc3nccn3C)cc2)c1 |
| InChI | InChI=1S/C18H18FN3O3S/c1-13-3-8-16(19)17(11-13)26(23,24)21-14-4-6-15(7-5-14)25-12-18-20-9-10-22(18)2/h3-11,21H,12H2,1-2H3 |
| InChIKey | QDLHUAOLWWMJKO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |