C19H30N4O3S — CID 75462883
N-[3-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]piperazin-1-yl]propyl]methanesulfonamide (PubChem CID 75462883) has the molecular formula C19H30N4O3S and a molecular weight of 394.54 g/mol. Its IUPAC name is N-[3-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]piperazin-1-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]piperazin-1-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 75462883 |
| Molecular Formula | C19H30N4O3S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-[3-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]piperazin-1-yl]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCN1CCN(CC(=O)N2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C19H30N4O3S/c1-27(25,26)20-9-5-10-21-12-14-22(15-13-21)16-19(24)23-11-4-7-17-6-2-3-8-18(17)23/h2-3,6,8,20H,4-5,7,9-16H2,1H3 |
| InChIKey | IXBMUVDRMCQIPA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|