C17H19N5OS2 — CID 75463597
N-[1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-2-methylpropyl]-2-thiophen-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 75463597) has the molecular formula C17H19N5OS2 and a molecular weight of 373.51 g/mol. Its IUPAC name is N-[1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-2-methylpropyl]-2-thiophen-3-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-2-methylpropyl]-2-thiophen-3-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 75463597 |
| Molecular Formula | C17H19N5OS2 |
| Molecular Weight | 373.51 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-[1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-2-methylpropyl]-2-thiophen-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | CC(C)C(NC(=O)c1cnc(-c2ccsc2)s1)c1nnc2n1CCC2 |
| InChI | InChI=1S/C17H19N5OS2/c1-10(2)14(15-21-20-13-4-3-6-22(13)15)19-16(23)12-8-18-17(25-12)11-5-7-24-9-11/h5,7-10,14H,3-4,6H2,1-2H3,(H,19,23) |
| InChIKey | CKHIJPZKHJFTIG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |