C17H29N3O4S — CID 75464073
4-[[[2-methoxyethyl(methyl)sulfamoyl]amino]methyl]-2-(4-methylcyclohexyl)oxypyridine (PubChem CID 75464073) has the molecular formula C17H29N3O4S and a molecular weight of 371.50 g/mol. Its IUPAC name is 4-[[[2-methoxyethyl(methyl)sulfamoyl]amino]methyl]-2-(4-methylcyclohexyl)oxypyridine.
| Compound Name | 4-[[[2-methoxyethyl(methyl)sulfamoyl]amino]methyl]-2-(4-methylcyclohexyl)oxypyridine |
|---|---|
| PubChem CID | 75464073 |
| Molecular Formula | C17H29N3O4S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 4-[[[2-methoxyethyl(methyl)sulfamoyl]amino]methyl]-2-(4-methylcyclohexyl)oxypyridine |
| SMILES | COCCN(C)S(=O)(=O)NCc1ccnc(OC2CCC(C)CC2)c1 |
| InChI | InChI=1S/C17H29N3O4S/c1-14-4-6-16(7-5-14)24-17-12-15(8-9-18-17)13-19-25(21,22)20(2)10-11-23-3/h8-9,12,14,16,19H,4-7,10-11,13H2,1-3H3 |
| InChIKey | YQRKBHGIBWQEKD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |