About spiro[1,2-dihydroindole-3,1'-cyclohexane];hydrochloride
spiro[1,2-dihydroindole-3,1'-cyclohexane];hydrochloride (PubChem CID 75465012) has the molecular formula C13H18ClN
and a molecular weight of 223.75 g/mol. Its IUPAC name is spiro[1,2-dihydroindole-3,1'-cyclohexane];hydrochloride.
Molecular Properties
| Compound Name | spiro[1,2-dihydroindole-3,1'-cyclohexane];hydrochloride |
| PubChem CID | 75465012 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | spiro[1,2-dihydroindole-3,1'-cyclohexane];hydrochloride |
| SMILES | Cl.c1ccc2c(c1)NCC21CCCCC1 |
| InChI | InChI=1S/C13H17N.ClH/c1-4-8-13(9-5-1)10-14-12-7-3-2-6-11(12)13;/h2-3,6-7,14H,1,4-5,8-10H2;1H |
| InChIKey | HBFFWXPAZNMUBR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[1,2-dihydroindole-3,1'-cyclohexane];hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,2-dihydroindole-3,1'-cyclohexane];hydrochloride?
The IUPAC name of spiro[1,2-dihydroindole-3,1'-cyclohexane];hydrochloride (CID 75465012) is spiro[1,2-dihydroindole-3,1'-cyclohexane];hydrochloride.
What is the SMILES notation for spiro[1,2-dihydroindole-3,1'-cyclohexane];hydrochloride?
The canonical SMILES for spiro[1,2-dihydroindole-3,1'-cyclohexane];hydrochloride is Cl.c1ccc2c(c1)NCC21CCCCC1.
What is the InChIKey of spiro[1,2-dihydroindole-3,1'-cyclohexane];hydrochloride?
The InChIKey is HBFFWXPAZNMUBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N.ClH/c1-4-8-13(9-5-1)10-14-12-7-3-2-6-11(12)13;/h2-3,6-7,14H,1,4-5,8-10H2;1H.
What are the key properties of spiro[1,2-dihydroindole-3,1'-cyclohexane];hydrochloride?
spiro[1,2-dihydroindole-3,1'-cyclohexane];hydrochloride has a molecular weight of 223.75 g/mol, XLogP of 3.74, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,2-dihydroindole-3,1'-cyclohexane];hydrochloride is sourced from PubChem (CID 75465012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).