About 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]acetic acid
2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]acetic acid (PubChem CID 75465053) has the molecular formula C5H3F3N2O3
and a molecular weight of 196.08 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]acetic acid |
| PubChem CID | 75465053 |
| Molecular Formula | C5H3F3N2O3 |
| Molecular Weight | 196.08 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]acetic acid |
| SMILES | O=C(O)Cc1nc(C(F)(F)F)no1 |
| InChI | InChI=1S/C5H3F3N2O3/c6-5(7,8)4-9-2(13-10-4)1-3(11)12/h1H2,(H,11,12) |
| InChIKey | XSYPUJPUSSJOGN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.08 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]acetic acid?
The IUPAC name of 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]acetic acid (CID 75465053) is 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]acetic acid.
What is the SMILES notation for 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]acetic acid?
The canonical SMILES for 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]acetic acid is O=C(O)Cc1nc(C(F)(F)F)no1.
What is the InChIKey of 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]acetic acid?
The InChIKey is XSYPUJPUSSJOGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3F3N2O3/c6-5(7,8)4-9-2(13-10-4)1-3(11)12/h1H2,(H,11,12).
What are the key properties of 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]acetic acid?
2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]acetic acid has a molecular weight of 196.08 g/mol, XLogP of 0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]acetic acid is sourced from PubChem (CID 75465053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).