C19H19NO6S2 — CID 75465168
ethyl 7-[2-(2-ethoxy-2-oxoethoxy)phenyl]-2-oxo-3,7-dihydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate (PubChem CID 75465168) has the molecular formula C19H19NO6S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is ethyl 7-[2-(2-ethoxy-2-oxoethoxy)phenyl]-2-oxo-3,7-dihydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate.
| Compound Name | ethyl 7-[2-(2-ethoxy-2-oxoethoxy)phenyl]-2-oxo-3,7-dihydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate |
|---|---|
| PubChem CID | 75465168 |
| Molecular Formula | C19H19NO6S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | ethyl 7-[2-(2-ethoxy-2-oxoethoxy)phenyl]-2-oxo-3,7-dihydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate |
| SMILES | CCOC(=O)COc1ccccc1C1C(C(=O)OCC)=CSc2[nH]c(=O)sc21 |
| InChI | InChI=1S/C19H19NO6S2/c1-3-24-14(21)9-26-13-8-6-5-7-11(13)15-12(18(22)25-4-2)10-27-17-16(15)28-19(23)20-17/h5-8,10,15H,3-4,9H2,1-2H3,(H,20,23) |
| InChIKey | HNBBLXRQMATNFD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|