C16H23N3O2 — CID 75465686
N-cyclohexyl-2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)acetamide (PubChem CID 75465686) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-cyclohexyl-2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)acetamide.
| Compound Name | N-cyclohexyl-2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)acetamide |
|---|---|
| PubChem CID | 75465686 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-cyclohexyl-2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)acetamide |
| SMILES | O=C(Cn1nc2c(cc1=O)CCCC2)NC1CCCCC1 |
| InChI | InChI=1S/C16H23N3O2/c20-15(17-13-7-2-1-3-8-13)11-19-16(21)10-12-6-4-5-9-14(12)18-19/h10,13H,1-9,11H2,(H,17,20) |
| InChIKey | GVXBWEOETLNODR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |