C21H24FN3O4 — CID 75466038
methyl 2-[1-[[2-[3-(2-fluorophenyl)-6-oxopyridazin-1-yl]acetyl]amino]cyclohexyl]acetate (PubChem CID 75466038) has the molecular formula C21H24FN3O4 and a molecular weight of 401.44 g/mol. Its IUPAC name is methyl 2-[1-[[2-[3-(2-fluorophenyl)-6-oxopyridazin-1-yl]acetyl]amino]cyclohexyl]acetate.
| Compound Name | methyl 2-[1-[[2-[3-(2-fluorophenyl)-6-oxopyridazin-1-yl]acetyl]amino]cyclohexyl]acetate |
|---|---|
| PubChem CID | 75466038 |
| Molecular Formula | C21H24FN3O4 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | methyl 2-[1-[[2-[3-(2-fluorophenyl)-6-oxopyridazin-1-yl]acetyl]amino]cyclohexyl]acetate |
| SMILES | COC(=O)CC1(NC(=O)Cn2nc(-c3ccccc3F)ccc2=O)CCCCC1 |
| InChI | InChI=1S/C21H24FN3O4/c1-29-20(28)13-21(11-5-2-6-12-21)23-18(26)14-25-19(27)10-9-17(24-25)15-7-3-4-8-16(15)22/h3-4,7-10H,2,5-6,11-14H2,1H3,(H,23,26) |
| InChIKey | YYLPVGKTMAUCGM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |