C19H18N4O4 — CID 75466099
N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)acetamide (PubChem CID 75466099) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)acetamide.
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)acetamide |
|---|---|
| PubChem CID | 75466099 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)acetamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)Cn3nc4c(cc3=O)CCCC4)cc2C1=O |
| InChI | InChI=1S/C19H18N4O4/c1-22-18(26)13-7-6-12(9-14(13)19(22)27)20-16(24)10-23-17(25)8-11-4-2-3-5-15(11)21-23/h6-9H,2-5,10H2,1H3,(H,20,24) |
| InChIKey | OOVIYUQEUMULAD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|