C44H48N6O — CID 75466485
(2E,6Z)-2,6-bis[[4-[5-(1-adamantyl)triazol-1-yl]phenyl]methylidene]cyclohexan-1-one (PubChem CID 75466485) has the molecular formula C44H48N6O and a molecular weight of 676.91 g/mol. Its IUPAC name is (2E,6Z)-2,6-bis[[4-[5-(1-adamantyl)triazol-1-yl]phenyl]methylidene]cyclohexan-1-one.
| Compound Name | (2E,6Z)-2,6-bis[[4-[5-(1-adamantyl)triazol-1-yl]phenyl]methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 75466485 |
| Molecular Formula | C44H48N6O |
| Molecular Weight | 676.91 g/mol |
| Exact Mass | 676.39 |
| IUPAC Name | (2E,6Z)-2,6-bis[[4-[5-(1-adamantyl)triazol-1-yl]phenyl]methylidene]cyclohexan-1-one |
| SMILES | O=C1/C(=C\c2ccc(-n3nncc3C34CC5CC(CC(C5)C3)C4)cc2)CCC/C1=C\c1ccc(-n2nncc2C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C44H48N6O/c51-42-36(18-28-4-8-38(9-5-28)49-40(26-45-47-49)43-20-30-12-31(21-43)14-32(13-30)22-43)2-1-3-37(42)19-29-6-10-39(11-7-29)50-41(27-46-48-50)44-23-33-15-34(24-44)17-35(16-33)25-44/h4-11,18-19,26-27,30-35H,1-3,12-17,20-25H2/b36-18-,37-19+ |
| InChIKey | KOKOVKGMNZMUAH-SHMBRFTLSA-N |
| XLogP | 9.00 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.91 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|