About 1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride
1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride (PubChem CID 75467773) has the molecular formula C5H10ClNO4S
and a molecular weight of 215.66 g/mol. Its IUPAC name is 1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride |
| PubChem CID | 75467773 |
| Molecular Formula | C5H10ClNO4S |
| Molecular Weight | 215.66 g/mol |
| Exact Mass | 215.00 |
| IUPAC Name | 1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1CS(=O)(=O)CCN1 |
| InChI | InChI=1S/C5H9NO4S.ClH/c7-5(8)4-3-11(9,10)2-1-6-4;/h4,6H,1-3H2,(H,7,8);1H |
| InChIKey | NJFKFCKXKGINON-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.66 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride?
The IUPAC name of 1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride (CID 75467773) is 1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride.
What is the SMILES notation for 1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride?
The canonical SMILES for 1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride is Cl.O=C(O)C1CS(=O)(=O)CCN1.
What is the InChIKey of 1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride?
The InChIKey is NJFKFCKXKGINON-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO4S.ClH/c7-5(8)4-3-11(9,10)2-1-6-4;/h4,6H,1-3H2,(H,7,8);1H.
What are the key properties of 1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride?
1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride has a molecular weight of 215.66 g/mol, XLogP of -1.12, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-1,4-thiazinane-3-carboxylic acid;hydrochloride is sourced from PubChem (CID 75467773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).