C21H24FN3O2 — CID 7546779
1-benzyl-3-[(3R)-1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-1-propan-2-ylurea (PubChem CID 7546779) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is 1-benzyl-3-[(3R)-1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-1-propan-2-ylurea.
| Compound Name | 1-benzyl-3-[(3R)-1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-1-propan-2-ylurea |
|---|---|
| PubChem CID | 7546779 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1-benzyl-3-[(3R)-1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-1-propan-2-ylurea |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)N[C@@H]1CC(=O)N(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C21H24FN3O2/c1-15(2)24(13-16-7-4-3-5-8-16)21(27)23-18-12-20(26)25(14-18)19-10-6-9-17(22)11-19/h3-11,15,18H,12-14H2,1-2H3,(H,23,27)/t18-/m1/s1 |
| InChIKey | LAUOCRHVNCRUNT-GOSISDBHSA-N |
| XLogP | 3.55 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |