About [(1S,2S)-2-methoxycyclopentyl] 2-propyl-1,3-thiazole-5-carboxylate
[(1S,2S)-2-methoxycyclopentyl] 2-propyl-1,3-thiazole-5-carboxylate (PubChem CID 75468044) has the molecular formula C13H19NO3S
and a molecular weight of 269.37 g/mol. Its IUPAC name is [(1S,2S)-2-methoxycyclopentyl] 2-propyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | [(1S,2S)-2-methoxycyclopentyl] 2-propyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 75468044 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | [(1S,2S)-2-methoxycyclopentyl] 2-propyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCc1ncc(C(=O)O[C@H]2CCC[C@@H]2OC)s1 |
| InChI | InChI=1S/C13H19NO3S/c1-3-5-12-14-8-11(18-12)13(15)17-10-7-4-6-9(10)16-2/h8-10H,3-7H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | GYSGMJQTGRNOLQ-UWVGGRQHSA-N |
| XLogP | 2.82 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1S,2S)-2-methoxycyclopentyl] 2-propyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-methoxycyclopentyl] 2-propyl-1,3-thiazole-5-carboxylate?
The IUPAC name of [(1S,2S)-2-methoxycyclopentyl] 2-propyl-1,3-thiazole-5-carboxylate (CID 75468044) is [(1S,2S)-2-methoxycyclopentyl] 2-propyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for [(1S,2S)-2-methoxycyclopentyl] 2-propyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for [(1S,2S)-2-methoxycyclopentyl] 2-propyl-1,3-thiazole-5-carboxylate is CCCc1ncc(C(=O)O[C@H]2CCC[C@@H]2OC)s1.
What is the InChIKey of [(1S,2S)-2-methoxycyclopentyl] 2-propyl-1,3-thiazole-5-carboxylate?
The InChIKey is GYSGMJQTGRNOLQ-UWVGGRQHSA-N. The full InChI is InChI=1S/C13H19NO3S/c1-3-5-12-14-8-11(18-12)13(15)17-10-7-4-6-9(10)16-2/h8-10H,3-7H2,1-2H3/t9-,10-/m0/s1.
What are the key properties of [(1S,2S)-2-methoxycyclopentyl] 2-propyl-1,3-thiazole-5-carboxylate?
[(1S,2S)-2-methoxycyclopentyl] 2-propyl-1,3-thiazole-5-carboxylate has a molecular weight of 269.37 g/mol, XLogP of 2.82, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-methoxycyclopentyl] 2-propyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 75468044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).