C17H25N3OS — CID 75468416
N-(1-pyridin-3-ylethyl)-1-thia-4-azaspiro[5.5]undecane-4-carboxamide (PubChem CID 75468416) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is N-(1-pyridin-3-ylethyl)-1-thia-4-azaspiro[5.5]undecane-4-carboxamide.
| Compound Name | N-(1-pyridin-3-ylethyl)-1-thia-4-azaspiro[5.5]undecane-4-carboxamide |
|---|---|
| PubChem CID | 75468416 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-(1-pyridin-3-ylethyl)-1-thia-4-azaspiro[5.5]undecane-4-carboxamide |
| SMILES | CC(NC(=O)N1CCSC2(CCCCC2)C1)c1cccnc1 |
| InChI | InChI=1S/C17H25N3OS/c1-14(15-6-5-9-18-12-15)19-16(21)20-10-11-22-17(13-20)7-3-2-4-8-17/h5-6,9,12,14H,2-4,7-8,10-11,13H2,1H3,(H,19,21) |
| InChIKey | BSQPFXHSDRRREJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |