About N-(3-chlorophenyl)-N-(2,2-difluoroethyl)-1-methyl-2-oxopiperidine-4-carboxamide
N-(3-chlorophenyl)-N-(2,2-difluoroethyl)-1-methyl-2-oxopiperidine-4-carboxamide (PubChem CID 75468522) has the molecular formula C15H17ClF2N2O2
and a molecular weight of 330.76 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-(2,2-difluoroethyl)-1-methyl-2-oxopiperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-(3-chlorophenyl)-N-(2,2-difluoroethyl)-1-methyl-2-oxopiperidine-4-carboxamide |
| PubChem CID | 75468522 |
| Molecular Formula | C15H17ClF2N2O2 |
| Molecular Weight | 330.76 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-(3-chlorophenyl)-N-(2,2-difluoroethyl)-1-methyl-2-oxopiperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)N(CC(F)F)c2cccc(Cl)c2)CC1=O |
| InChI | InChI=1S/C15H17ClF2N2O2/c1-19-6-5-10(7-14(19)21)15(22)20(9-13(17)18)12-4-2-3-11(16)8-12/h2-4,8,10,13H,5-7,9H2,1H3 |
| InChIKey | UKXBQUUMTDCEBQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.76 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-chlorophenyl)-N-(2,2-difluoroethyl)-1-methyl-2-oxopiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chlorophenyl)-N-(2,2-difluoroethyl)-1-methyl-2-oxopiperidine-4-carboxamide?
The IUPAC name of N-(3-chlorophenyl)-N-(2,2-difluoroethyl)-1-methyl-2-oxopiperidine-4-carboxamide (CID 75468522) is N-(3-chlorophenyl)-N-(2,2-difluoroethyl)-1-methyl-2-oxopiperidine-4-carboxamide.
What is the SMILES notation for N-(3-chlorophenyl)-N-(2,2-difluoroethyl)-1-methyl-2-oxopiperidine-4-carboxamide?
The canonical SMILES for N-(3-chlorophenyl)-N-(2,2-difluoroethyl)-1-methyl-2-oxopiperidine-4-carboxamide is CN1CCC(C(=O)N(CC(F)F)c2cccc(Cl)c2)CC1=O.
What is the InChIKey of N-(3-chlorophenyl)-N-(2,2-difluoroethyl)-1-methyl-2-oxopiperidine-4-carboxamide?
The InChIKey is UKXBQUUMTDCEBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClF2N2O2/c1-19-6-5-10(7-14(19)21)15(22)20(9-13(17)18)12-4-2-3-11(16)8-12/h2-4,8,10,13H,5-7,9H2,1H3.
What are the key properties of N-(3-chlorophenyl)-N-(2,2-difluoroethyl)-1-methyl-2-oxopiperidine-4-carboxamide?
N-(3-chlorophenyl)-N-(2,2-difluoroethyl)-1-methyl-2-oxopiperidine-4-carboxamide has a molecular weight of 330.76 g/mol, XLogP of 2.81, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chlorophenyl)-N-(2,2-difluoroethyl)-1-methyl-2-oxopiperidine-4-carboxamide is sourced from PubChem (CID 75468522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).