About 2-(2-methyl-3-methylsulfonylpropyl)sulfanyl-4H-3,1-benzothiazine
2-(2-methyl-3-methylsulfonylpropyl)sulfanyl-4H-3,1-benzothiazine (PubChem CID 75468746) has the molecular formula C13H17NO2S3
and a molecular weight of 315.48 g/mol. Its IUPAC name is 2-(2-methyl-3-methylsulfonylpropyl)sulfanyl-4H-3,1-benzothiazine.
Molecular Properties
| Compound Name | 2-(2-methyl-3-methylsulfonylpropyl)sulfanyl-4H-3,1-benzothiazine |
| PubChem CID | 75468746 |
| Molecular Formula | C13H17NO2S3 |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2-(2-methyl-3-methylsulfonylpropyl)sulfanyl-4H-3,1-benzothiazine |
| SMILES | CC(CSC1=Nc2ccccc2CS1)CS(C)(=O)=O |
| InChI | InChI=1S/C13H17NO2S3/c1-10(9-19(2,15)16)7-17-13-14-12-6-4-3-5-11(12)8-18-13/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | LFDPCHBESXFQRW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-methyl-3-methylsulfonylpropyl)sulfanyl-4H-3,1-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-3-methylsulfonylpropyl)sulfanyl-4H-3,1-benzothiazine?
The IUPAC name of 2-(2-methyl-3-methylsulfonylpropyl)sulfanyl-4H-3,1-benzothiazine (CID 75468746) is 2-(2-methyl-3-methylsulfonylpropyl)sulfanyl-4H-3,1-benzothiazine.
What is the SMILES notation for 2-(2-methyl-3-methylsulfonylpropyl)sulfanyl-4H-3,1-benzothiazine?
The canonical SMILES for 2-(2-methyl-3-methylsulfonylpropyl)sulfanyl-4H-3,1-benzothiazine is CC(CSC1=Nc2ccccc2CS1)CS(C)(=O)=O.
What is the InChIKey of 2-(2-methyl-3-methylsulfonylpropyl)sulfanyl-4H-3,1-benzothiazine?
The InChIKey is LFDPCHBESXFQRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2S3/c1-10(9-19(2,15)16)7-17-13-14-12-6-4-3-5-11(12)8-18-13/h3-6,10H,7-9H2,1-2H3.
What are the key properties of 2-(2-methyl-3-methylsulfonylpropyl)sulfanyl-4H-3,1-benzothiazine?
2-(2-methyl-3-methylsulfonylpropyl)sulfanyl-4H-3,1-benzothiazine has a molecular weight of 315.48 g/mol, XLogP of 3.33, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-3-methylsulfonylpropyl)sulfanyl-4H-3,1-benzothiazine is sourced from PubChem (CID 75468746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).