C16H22ClNO2S — CID 75468918
2-[1-(4-chlorophenyl)propylsulfanyl]-N-(oxolan-3-ylmethyl)acetamide (PubChem CID 75468918) has the molecular formula C16H22ClNO2S and a molecular weight of 327.88 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)propylsulfanyl]-N-(oxolan-3-ylmethyl)acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)propylsulfanyl]-N-(oxolan-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 75468918 |
| Molecular Formula | C16H22ClNO2S |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-[1-(4-chlorophenyl)propylsulfanyl]-N-(oxolan-3-ylmethyl)acetamide |
| SMILES | CCC(SCC(=O)NCC1CCOC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H22ClNO2S/c1-2-15(13-3-5-14(17)6-4-13)21-11-16(19)18-9-12-7-8-20-10-12/h3-6,12,15H,2,7-11H2,1H3,(H,18,19) |
| InChIKey | DBOOULIRNQGJAJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |