C19H27N3O4 — CID 75469157
2-[[1-(dimethylcarbamoyl)piperidine-3-carbonyl]amino]-2-methyl-3-phenylpropanoic acid (PubChem CID 75469157) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-[[1-(dimethylcarbamoyl)piperidine-3-carbonyl]amino]-2-methyl-3-phenylpropanoic acid.
| Compound Name | 2-[[1-(dimethylcarbamoyl)piperidine-3-carbonyl]amino]-2-methyl-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 75469157 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 2-[[1-(dimethylcarbamoyl)piperidine-3-carbonyl]amino]-2-methyl-3-phenylpropanoic acid |
| SMILES | CN(C)C(=O)N1CCCC(C(=O)NC(C)(Cc2ccccc2)C(=O)O)C1 |
| InChI | InChI=1S/C19H27N3O4/c1-19(17(24)25,12-14-8-5-4-6-9-14)20-16(23)15-10-7-11-22(13-15)18(26)21(2)3/h4-6,8-9,15H,7,10-13H2,1-3H3,(H,20,23)(H,24,25) |
| InChIKey | OKIOQAOLMOKPTD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |