C11H22N2O3S — CID 75469233
N-[2-(2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl)ethyl]methanesulfonamide (PubChem CID 75469233) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is N-[2-(2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl)ethyl]methanesulfonamide.
| Compound Name | N-[2-(2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 75469233 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N-[2-(2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl)ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCN1CCC2OCCCC2C1 |
| InChI | InChI=1S/C11H22N2O3S/c1-17(14,15)12-5-7-13-6-4-11-10(9-13)3-2-8-16-11/h10-12H,2-9H2,1H3 |
| InChIKey | OJIUFYQIVARVHC-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |