C13H16FN3O2 — CID 7546969
1-ethyl-3-[(3S)-1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]urea (PubChem CID 7546969) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is 1-ethyl-3-[(3S)-1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-ethyl-3-[(3S)-1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 7546969 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-ethyl-3-[(3S)-1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]urea |
| SMILES | CCNC(=O)N[C@H]1CC(=O)N(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C13H16FN3O2/c1-2-15-13(19)16-10-7-12(18)17(8-10)11-5-3-4-9(14)6-11/h3-6,10H,2,7-8H2,1H3,(H2,15,16,19)/t10-/m0/s1 |
| InChIKey | NQABLGAAJLVEHS-JTQLQIEISA-N |
| XLogP | 1.25 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |