C10H13NS — CID 75469820
8-methyl-2,3,4,5-tetrahydro-1,5-benzothiazepine (PubChem CID 75469820) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 8-methyl-2,3,4,5-tetrahydro-1,5-benzothiazepine.
| Compound Name | 8-methyl-2,3,4,5-tetrahydro-1,5-benzothiazepine |
|---|---|
| PubChem CID | 75469820 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 8-methyl-2,3,4,5-tetrahydro-1,5-benzothiazepine |
| SMILES | Cc1ccc2c(c1)SCCCN2 |
| InChI | InChI=1S/C10H13NS/c1-8-3-4-9-10(7-8)12-6-2-5-11-9/h3-4,7,11H,2,5-6H2,1H3 |
| InChIKey | CYZUZKUAVHWEHR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |