C17H20N2OS — CID 754702
(5Z)-5-[(4-propan-2-ylphenyl)methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one (PubChem CID 754702) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is (5Z)-5-[(4-propan-2-ylphenyl)methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[(4-propan-2-ylphenyl)methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 754702 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (5Z)-5-[(4-propan-2-ylphenyl)methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one |
| SMILES | CC(C)c1ccc(/C=C2\SC(N3CCCC3)=NC2=O)cc1 |
| InChI | InChI=1S/C17H20N2OS/c1-12(2)14-7-5-13(6-8-14)11-15-16(20)18-17(21-15)19-9-3-4-10-19/h5-8,11-12H,3-4,9-10H2,1-2H3/b15-11- |
| InChIKey | OXVDQYDHDVMVMK-PTNGSMBKSA-N |
| XLogP | 3.88 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|