About 1-(1-methyl-1,2,4-triazol-3-yl)ethanamine;hydrochloride
1-(1-methyl-1,2,4-triazol-3-yl)ethanamine;hydrochloride (PubChem CID 75470322) has the molecular formula C5H11ClN4
and a molecular weight of 162.62 g/mol. Its IUPAC name is 1-(1-methyl-1,2,4-triazol-3-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-(1-methyl-1,2,4-triazol-3-yl)ethanamine;hydrochloride |
| PubChem CID | 75470322 |
| Molecular Formula | C5H11ClN4 |
| Molecular Weight | 162.62 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 1-(1-methyl-1,2,4-triazol-3-yl)ethanamine;hydrochloride |
| SMILES | CC(N)c1ncn(C)n1.Cl |
| InChI | InChI=1S/C5H10N4.ClH/c1-4(6)5-7-3-9(2)8-5;/h3-4H,6H2,1-2H3;1H |
| InChIKey | RNVCHOPWLVALNI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.62 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1-methyl-1,2,4-triazol-3-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methyl-1,2,4-triazol-3-yl)ethanamine;hydrochloride?
The IUPAC name of 1-(1-methyl-1,2,4-triazol-3-yl)ethanamine;hydrochloride (CID 75470322) is 1-(1-methyl-1,2,4-triazol-3-yl)ethanamine;hydrochloride.
What is the SMILES notation for 1-(1-methyl-1,2,4-triazol-3-yl)ethanamine;hydrochloride?
The canonical SMILES for 1-(1-methyl-1,2,4-triazol-3-yl)ethanamine;hydrochloride is CC(N)c1ncn(C)n1.Cl.
What is the InChIKey of 1-(1-methyl-1,2,4-triazol-3-yl)ethanamine;hydrochloride?
The InChIKey is RNVCHOPWLVALNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4.ClH/c1-4(6)5-7-3-9(2)8-5;/h3-4H,6H2,1-2H3;1H.
What are the key properties of 1-(1-methyl-1,2,4-triazol-3-yl)ethanamine;hydrochloride?
1-(1-methyl-1,2,4-triazol-3-yl)ethanamine;hydrochloride has a molecular weight of 162.62 g/mol, XLogP of 0.26, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methyl-1,2,4-triazol-3-yl)ethanamine;hydrochloride is sourced from PubChem (CID 75470322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).