About 5-cyclopropyl-N-methyl-N-(3-methylsulfonylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide
5-cyclopropyl-N-methyl-N-(3-methylsulfonylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide (PubChem CID 75470449) has the molecular formula C20H20N4O3S
and a molecular weight of 396.47 g/mol. Its IUPAC name is 5-cyclopropyl-N-methyl-N-(3-methylsulfonylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-cyclopropyl-N-methyl-N-(3-methylsulfonylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide |
| PubChem CID | 75470449 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 5-cyclopropyl-N-methyl-N-(3-methylsulfonylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide |
| SMILES | CN(C(=O)c1nc(C2CC2)n(-c2ccccc2)n1)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H20N4O3S/c1-23(16-9-6-10-17(13-16)28(2,26)27)20(25)18-21-19(14-11-12-14)24(22-18)15-7-4-3-5-8-15/h3-10,13-14H,11-12H2,1-2H3 |
| InChIKey | FJWMXYJMOJXREZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-cyclopropyl-N-methyl-N-(3-methylsulfonylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-N-methyl-N-(3-methylsulfonylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide?
The IUPAC name of 5-cyclopropyl-N-methyl-N-(3-methylsulfonylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide (CID 75470449) is 5-cyclopropyl-N-methyl-N-(3-methylsulfonylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for 5-cyclopropyl-N-methyl-N-(3-methylsulfonylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide?
The canonical SMILES for 5-cyclopropyl-N-methyl-N-(3-methylsulfonylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide is CN(C(=O)c1nc(C2CC2)n(-c2ccccc2)n1)c1cccc(S(C)(=O)=O)c1.
What is the InChIKey of 5-cyclopropyl-N-methyl-N-(3-methylsulfonylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide?
The InChIKey is FJWMXYJMOJXREZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O3S/c1-23(16-9-6-10-17(13-16)28(2,26)27)20(25)18-21-19(14-11-12-14)24(22-18)15-7-4-3-5-8-15/h3-10,13-14H,11-12H2,1-2H3.
What are the key properties of 5-cyclopropyl-N-methyl-N-(3-methylsulfonylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide?
5-cyclopropyl-N-methyl-N-(3-methylsulfonylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide has a molecular weight of 396.47 g/mol, XLogP of 2.82, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-N-methyl-N-(3-methylsulfonylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 75470449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).