C15H14ClN3O3 — CID 75470569
(E)-3-(3-chlorophenyl)-1-[3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]prop-2-en-1-one (PubChem CID 75470569) has the molecular formula C15H14ClN3O3 and a molecular weight of 319.75 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-1-[3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-chlorophenyl)-1-[3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 75470569 |
| Molecular Formula | C15H14ClN3O3 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-1-[3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)N1CCOCC1c1ncon1 |
| InChI | InChI=1S/C15H14ClN3O3/c16-12-3-1-2-11(8-12)4-5-14(20)19-6-7-21-9-13(19)15-17-10-22-18-15/h1-5,8,10,13H,6-7,9H2/b5-4+ |
| InChIKey | FNTVAULSBJJVNK-SNAWJCMRSA-N |
| XLogP | 2.34 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|