C19H32N4O2 — CID 75470622
2-N,4-N-bis(2,6-dimethyloxan-4-yl)-5-methylpyrimidine-2,4-diamine (PubChem CID 75470622) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-N,4-N-bis(2,6-dimethyloxan-4-yl)-5-methylpyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(2,6-dimethyloxan-4-yl)-5-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 75470622 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 2-N,4-N-bis(2,6-dimethyloxan-4-yl)-5-methylpyrimidine-2,4-diamine |
| SMILES | Cc1cnc(NC2CC(C)OC(C)C2)nc1NC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C19H32N4O2/c1-11-10-20-19(22-17-8-14(4)25-15(5)9-17)23-18(11)21-16-6-12(2)24-13(3)7-16/h10,12-17H,6-9H2,1-5H3,(H2,20,21,22,23) |
| InChIKey | NEQPYEBRXHURRH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |