C16H32N2O3S — CID 75471733
1-(4-methylpiperidin-1-yl)-3-[(2-methylsulfonylcyclohexyl)amino]propan-2-ol (PubChem CID 75471733) has the molecular formula C16H32N2O3S and a molecular weight of 332.51 g/mol. Its IUPAC name is 1-(4-methylpiperidin-1-yl)-3-[(2-methylsulfonylcyclohexyl)amino]propan-2-ol.
| Compound Name | 1-(4-methylpiperidin-1-yl)-3-[(2-methylsulfonylcyclohexyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 75471733 |
| Molecular Formula | C16H32N2O3S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 1-(4-methylpiperidin-1-yl)-3-[(2-methylsulfonylcyclohexyl)amino]propan-2-ol |
| SMILES | CC1CCN(CC(O)CNC2CCCCC2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H32N2O3S/c1-13-7-9-18(10-8-13)12-14(19)11-17-15-5-3-4-6-16(15)22(2,20)21/h13-17,19H,3-12H2,1-2H3 |
| InChIKey | IBKYVEJZYBSDGS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |