About 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]-2,3-dihydro-1H-inden-1-ol
2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]-2,3-dihydro-1H-inden-1-ol (PubChem CID 75471961) has the molecular formula C17H22N2O2S
and a molecular weight of 318.44 g/mol. Its IUPAC name is 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 75471961 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]-2,3-dihydro-1H-inden-1-ol |
| SMILES | COC(C)c1nc(CN(C)C2Cc3ccccc3C2O)cs1 |
| InChI | InChI=1S/C17H22N2O2S/c1-11(21-3)17-18-13(10-22-17)9-19(2)15-8-12-6-4-5-7-14(12)16(15)20/h4-7,10-11,15-16,20H,8-9H2,1-3H3 |
| InChIKey | PSNMMBFCLUIMKC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]-2,3-dihydro-1H-inden-1-ol (CID 75471961) is 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]-2,3-dihydro-1H-inden-1-ol is COC(C)c1nc(CN(C)C2Cc3ccccc3C2O)cs1.
What is the InChIKey of 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]-2,3-dihydro-1H-inden-1-ol?
The InChIKey is PSNMMBFCLUIMKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2S/c1-11(21-3)17-18-13(10-22-17)9-19(2)15-8-12-6-4-5-7-14(12)16(15)20/h4-7,10-11,15-16,20H,8-9H2,1-3H3.
What are the key properties of 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]-2,3-dihydro-1H-inden-1-ol?
2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]-2,3-dihydro-1H-inden-1-ol has a molecular weight of 318.44 g/mol, XLogP of 2.94, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-methylamino]-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 75471961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).