C18H22F3N5O2 — CID 75472728
N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclohexyl]-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide (PubChem CID 75472728) has the molecular formula C18H22F3N5O2 and a molecular weight of 397.40 g/mol. Its IUPAC name is N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclohexyl]-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide.
| Compound Name | N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclohexyl]-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 75472728 |
| Molecular Formula | C18H22F3N5O2 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclohexyl]-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide |
| SMILES | Cc1nc(C2(NC(=O)C3CCn4c(cnc4C(F)(F)F)C3)CCCCC2)no1 |
| InChI | InChI=1S/C18H22F3N5O2/c1-11-23-15(25-28-11)17(6-3-2-4-7-17)24-14(27)12-5-8-26-13(9-12)10-22-16(26)18(19,20)21/h10,12H,2-9H2,1H3,(H,24,27) |
| InChIKey | DEDDKAMFYJZLTK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |