About 1-[(1-phenyl-1,2,4-triazol-3-yl)methyl]-4-(triazol-1-yl)piperidine
1-[(1-phenyl-1,2,4-triazol-3-yl)methyl]-4-(triazol-1-yl)piperidine (PubChem CID 75472900) has the molecular formula C16H19N7
and a molecular weight of 309.38 g/mol. Its IUPAC name is 1-[(1-phenyl-1,2,4-triazol-3-yl)methyl]-4-(triazol-1-yl)piperidine.
Molecular Properties
| Compound Name | 1-[(1-phenyl-1,2,4-triazol-3-yl)methyl]-4-(triazol-1-yl)piperidine |
| PubChem CID | 75472900 |
| Molecular Formula | C16H19N7 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-[(1-phenyl-1,2,4-triazol-3-yl)methyl]-4-(triazol-1-yl)piperidine |
| SMILES | c1ccc(-n2cnc(CN3CCC(n4ccnn4)CC3)n2)cc1 |
| InChI | InChI=1S/C16H19N7/c1-2-4-14(5-3-1)23-13-17-16(19-23)12-21-9-6-15(7-10-21)22-11-8-18-20-22/h1-5,8,11,13,15H,6-7,9-10,12H2 |
| InChIKey | IRWSVOYVZIEPMQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(1-phenyl-1,2,4-triazol-3-yl)methyl]-4-(triazol-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-phenyl-1,2,4-triazol-3-yl)methyl]-4-(triazol-1-yl)piperidine?
The IUPAC name of 1-[(1-phenyl-1,2,4-triazol-3-yl)methyl]-4-(triazol-1-yl)piperidine (CID 75472900) is 1-[(1-phenyl-1,2,4-triazol-3-yl)methyl]-4-(triazol-1-yl)piperidine.
What is the SMILES notation for 1-[(1-phenyl-1,2,4-triazol-3-yl)methyl]-4-(triazol-1-yl)piperidine?
The canonical SMILES for 1-[(1-phenyl-1,2,4-triazol-3-yl)methyl]-4-(triazol-1-yl)piperidine is c1ccc(-n2cnc(CN3CCC(n4ccnn4)CC3)n2)cc1.
What is the InChIKey of 1-[(1-phenyl-1,2,4-triazol-3-yl)methyl]-4-(triazol-1-yl)piperidine?
The InChIKey is IRWSVOYVZIEPMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N7/c1-2-4-14(5-3-1)23-13-17-16(19-23)12-21-9-6-15(7-10-21)22-11-8-18-20-22/h1-5,8,11,13,15H,6-7,9-10,12H2.
What are the key properties of 1-[(1-phenyl-1,2,4-triazol-3-yl)methyl]-4-(triazol-1-yl)piperidine?
1-[(1-phenyl-1,2,4-triazol-3-yl)methyl]-4-(triazol-1-yl)piperidine has a molecular weight of 309.38 g/mol, XLogP of 1.70, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-phenyl-1,2,4-triazol-3-yl)methyl]-4-(triazol-1-yl)piperidine is sourced from PubChem (CID 75472900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).