C17H24N4O — CID 75473179
[1-[2-[(2-methylpyrazol-3-yl)methylamino]phenyl]piperidin-4-yl]methanol (PubChem CID 75473179) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is [1-[2-[(2-methylpyrazol-3-yl)methylamino]phenyl]piperidin-4-yl]methanol.
| Compound Name | [1-[2-[(2-methylpyrazol-3-yl)methylamino]phenyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 75473179 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | [1-[2-[(2-methylpyrazol-3-yl)methylamino]phenyl]piperidin-4-yl]methanol |
| SMILES | Cn1nccc1CNc1ccccc1N1CCC(CO)CC1 |
| InChI | InChI=1S/C17H24N4O/c1-20-15(6-9-19-20)12-18-16-4-2-3-5-17(16)21-10-7-14(13-22)8-11-21/h2-6,9,14,18,22H,7-8,10-13H2,1H3 |
| InChIKey | QQVCLERJOMSQLE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |