About [2-[[4-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]amino]-1-methylcyclopentyl]methanol
[2-[[4-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]amino]-1-methylcyclopentyl]methanol (PubChem CID 75473258) has the molecular formula C17H29N3O2
and a molecular weight of 307.44 g/mol. Its IUPAC name is [2-[[4-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]amino]-1-methylcyclopentyl]methanol.
Molecular Properties
| Compound Name | [2-[[4-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]amino]-1-methylcyclopentyl]methanol |
| PubChem CID | 75473258 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | [2-[[4-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]amino]-1-methylcyclopentyl]methanol |
| SMILES | CCc1noc(C2CCC(NC3CCCC3(C)CO)CC2)n1 |
| InChI | InChI=1S/C17H29N3O2/c1-3-15-19-16(22-20-15)12-6-8-13(9-7-12)18-14-5-4-10-17(14,2)11-21/h12-14,18,21H,3-11H2,1-2H3 |
| InChIKey | OHDMVFHUZJGYCW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[[4-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]amino]-1-methylcyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[4-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]amino]-1-methylcyclopentyl]methanol?
The IUPAC name of [2-[[4-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]amino]-1-methylcyclopentyl]methanol (CID 75473258) is [2-[[4-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]amino]-1-methylcyclopentyl]methanol.
What is the SMILES notation for [2-[[4-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]amino]-1-methylcyclopentyl]methanol?
The canonical SMILES for [2-[[4-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]amino]-1-methylcyclopentyl]methanol is CCc1noc(C2CCC(NC3CCCC3(C)CO)CC2)n1.
What is the InChIKey of [2-[[4-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]amino]-1-methylcyclopentyl]methanol?
The InChIKey is OHDMVFHUZJGYCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N3O2/c1-3-15-19-16(22-20-15)12-6-8-13(9-7-12)18-14-5-4-10-17(14,2)11-21/h12-14,18,21H,3-11H2,1-2H3.
What are the key properties of [2-[[4-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]amino]-1-methylcyclopentyl]methanol?
[2-[[4-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]amino]-1-methylcyclopentyl]methanol has a molecular weight of 307.44 g/mol, XLogP of 2.80, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[4-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]amino]-1-methylcyclopentyl]methanol is sourced from PubChem (CID 75473258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).