C16H27N5O — CID 75473933
1-cyclohexyl-3-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)urea (PubChem CID 75473933) has the molecular formula C16H27N5O and a molecular weight of 305.43 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)urea.
| Compound Name | 1-cyclohexyl-3-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)urea |
|---|---|
| PubChem CID | 75473933 |
| Molecular Formula | C16H27N5O |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 1-cyclohexyl-3-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)urea |
| SMILES | CC(C)c1nnc2n1CC(NC(=O)NC1CCCCC1)CC2 |
| InChI | InChI=1S/C16H27N5O/c1-11(2)15-20-19-14-9-8-13(10-21(14)15)18-16(22)17-12-6-4-3-5-7-12/h11-13H,3-10H2,1-2H3,(H2,17,18,22) |
| InChIKey | DZMRUPZEWCUIDK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |