C20H19FN6 — CID 75475511
3-(4-fluorophenyl)-N-(imidazo[1,2-a]pyridin-5-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine (PubChem CID 75475511) has the molecular formula C20H19FN6 and a molecular weight of 362.41 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(imidazo[1,2-a]pyridin-5-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine.
| Compound Name | 3-(4-fluorophenyl)-N-(imidazo[1,2-a]pyridin-5-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
|---|---|
| PubChem CID | 75475511 |
| Molecular Formula | C20H19FN6 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(imidazo[1,2-a]pyridin-5-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
| SMILES | Fc1ccc(-c2nnc3n2CC(NCc2cccc4nccn24)CC3)cc1 |
| InChI | InChI=1S/C20H19FN6/c21-15-6-4-14(5-7-15)20-25-24-19-9-8-16(13-27(19)20)23-12-17-2-1-3-18-22-10-11-26(17)18/h1-7,10-11,16,23H,8-9,12-13H2 |
| InChIKey | FDIZZUUYUZTUOB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 60.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |