About N-(1-phenyl-1,2,4-triazol-3-yl)thiophene-2-sulfonamide
N-(1-phenyl-1,2,4-triazol-3-yl)thiophene-2-sulfonamide (PubChem CID 75476470) has the molecular formula C12H10N4O2S2
and a molecular weight of 306.37 g/mol. Its IUPAC name is N-(1-phenyl-1,2,4-triazol-3-yl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-(1-phenyl-1,2,4-triazol-3-yl)thiophene-2-sulfonamide |
| PubChem CID | 75476470 |
| Molecular Formula | C12H10N4O2S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | N-(1-phenyl-1,2,4-triazol-3-yl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ncn(-c2ccccc2)n1)c1cccs1 |
| InChI | InChI=1S/C12H10N4O2S2/c17-20(18,11-7-4-8-19-11)15-12-13-9-16(14-12)10-5-2-1-3-6-10/h1-9H,(H,14,15) |
| InChIKey | QHKQITGTWGFRIX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(1-phenyl-1,2,4-triazol-3-yl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-phenyl-1,2,4-triazol-3-yl)thiophene-2-sulfonamide?
The IUPAC name of N-(1-phenyl-1,2,4-triazol-3-yl)thiophene-2-sulfonamide (CID 75476470) is N-(1-phenyl-1,2,4-triazol-3-yl)thiophene-2-sulfonamide.
What is the SMILES notation for N-(1-phenyl-1,2,4-triazol-3-yl)thiophene-2-sulfonamide?
The canonical SMILES for N-(1-phenyl-1,2,4-triazol-3-yl)thiophene-2-sulfonamide is O=S(=O)(Nc1ncn(-c2ccccc2)n1)c1cccs1.
What is the InChIKey of N-(1-phenyl-1,2,4-triazol-3-yl)thiophene-2-sulfonamide?
The InChIKey is QHKQITGTWGFRIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O2S2/c17-20(18,11-7-4-8-19-11)15-12-13-9-16(14-12)10-5-2-1-3-6-10/h1-9H,(H,14,15).
What are the key properties of N-(1-phenyl-1,2,4-triazol-3-yl)thiophene-2-sulfonamide?
N-(1-phenyl-1,2,4-triazol-3-yl)thiophene-2-sulfonamide has a molecular weight of 306.37 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-phenyl-1,2,4-triazol-3-yl)thiophene-2-sulfonamide is sourced from PubChem (CID 75476470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).