About N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonyl-2-methylpropanamide
N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonyl-2-methylpropanamide (PubChem CID 75477107) has the molecular formula C13H23N3O3S
and a molecular weight of 301.41 g/mol. Its IUPAC name is N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonyl-2-methylpropanamide.
Molecular Properties
| Compound Name | N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonyl-2-methylpropanamide |
| PubChem CID | 75477107 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonyl-2-methylpropanamide |
| SMILES | Cc1nn(CC(C)C)c(C)c1S(=O)(=O)NC(=O)C(C)C |
| InChI | InChI=1S/C13H23N3O3S/c1-8(2)7-16-11(6)12(10(5)14-16)20(18,19)15-13(17)9(3)4/h8-9H,7H2,1-6H3,(H,15,17) |
| InChIKey | SAYXKUURULPAMH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonyl-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonyl-2-methylpropanamide?
The IUPAC name of N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonyl-2-methylpropanamide (CID 75477107) is N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonyl-2-methylpropanamide.
What is the SMILES notation for N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonyl-2-methylpropanamide?
The canonical SMILES for N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonyl-2-methylpropanamide is Cc1nn(CC(C)C)c(C)c1S(=O)(=O)NC(=O)C(C)C.
What is the InChIKey of N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonyl-2-methylpropanamide?
The InChIKey is SAYXKUURULPAMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O3S/c1-8(2)7-16-11(6)12(10(5)14-16)20(18,19)15-13(17)9(3)4/h8-9H,7H2,1-6H3,(H,15,17).
What are the key properties of N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonyl-2-methylpropanamide?
N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonyl-2-methylpropanamide has a molecular weight of 301.41 g/mol, XLogP of 1.62, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]sulfonyl-2-methylpropanamide is sourced from PubChem (CID 75477107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).