About 2-[1-(3,3-dimethylbutylsulfonyl)piperidin-4-yl]-N,N-dimethylethanamine
2-[1-(3,3-dimethylbutylsulfonyl)piperidin-4-yl]-N,N-dimethylethanamine (PubChem CID 75477666) has the molecular formula C15H32N2O2S
and a molecular weight of 304.50 g/mol. Its IUPAC name is 2-[1-(3,3-dimethylbutylsulfonyl)piperidin-4-yl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[1-(3,3-dimethylbutylsulfonyl)piperidin-4-yl]-N,N-dimethylethanamine |
| PubChem CID | 75477666 |
| Molecular Formula | C15H32N2O2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-[1-(3,3-dimethylbutylsulfonyl)piperidin-4-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCC1CCN(S(=O)(=O)CCC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H32N2O2S/c1-15(2,3)9-13-20(18,19)17-11-7-14(8-12-17)6-10-16(4)5/h14H,6-13H2,1-5H3 |
| InChIKey | ADGGNZMEQICYMA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-(3,3-dimethylbutylsulfonyl)piperidin-4-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3,3-dimethylbutylsulfonyl)piperidin-4-yl]-N,N-dimethylethanamine?
The IUPAC name of 2-[1-(3,3-dimethylbutylsulfonyl)piperidin-4-yl]-N,N-dimethylethanamine (CID 75477666) is 2-[1-(3,3-dimethylbutylsulfonyl)piperidin-4-yl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[1-(3,3-dimethylbutylsulfonyl)piperidin-4-yl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[1-(3,3-dimethylbutylsulfonyl)piperidin-4-yl]-N,N-dimethylethanamine is CN(C)CCC1CCN(S(=O)(=O)CCC(C)(C)C)CC1.
What is the InChIKey of 2-[1-(3,3-dimethylbutylsulfonyl)piperidin-4-yl]-N,N-dimethylethanamine?
The InChIKey is ADGGNZMEQICYMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2O2S/c1-15(2,3)9-13-20(18,19)17-11-7-14(8-12-17)6-10-16(4)5/h14H,6-13H2,1-5H3.
What are the key properties of 2-[1-(3,3-dimethylbutylsulfonyl)piperidin-4-yl]-N,N-dimethylethanamine?
2-[1-(3,3-dimethylbutylsulfonyl)piperidin-4-yl]-N,N-dimethylethanamine has a molecular weight of 304.50 g/mol, XLogP of 2.42, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3,3-dimethylbutylsulfonyl)piperidin-4-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 75477666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).