C18H24FN3O2 — CID 7547783
(2R)-2-ethyl-N-[(3R)-1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]piperidine-1-carboxamide (PubChem CID 7547783) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is (2R)-2-ethyl-N-[(3R)-1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]piperidine-1-carboxamide.
| Compound Name | (2R)-2-ethyl-N-[(3R)-1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 7547783 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (2R)-2-ethyl-N-[(3R)-1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]piperidine-1-carboxamide |
| SMILES | CC[C@@H]1CCCCN1C(=O)N[C@@H]1CC(=O)N(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H24FN3O2/c1-2-15-5-3-4-10-21(15)18(24)20-14-11-17(23)22(12-14)16-8-6-13(19)7-9-16/h6-9,14-15H,2-5,10-12H2,1H3,(H,20,24)/t14-,15-/m1/s1 |
| InChIKey | FMUQROGQDUEJKA-HUUCEWRRSA-N |
| XLogP | 2.91 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |